C8H18N2S2 — CID 115635668
1-ethyl-3-(4-methylsulfanylbutan-2-yl)thiourea (PubChem CID 115635668) has the molecular formula C8H18N2S2 and a molecular weight of 206.38 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylsulfanylbutan-2-yl)thiourea.
| Compound Name | 1-ethyl-3-(4-methylsulfanylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 115635668 |
| Molecular Formula | C8H18N2S2 |
| Molecular Weight | 206.38 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-ethyl-3-(4-methylsulfanylbutan-2-yl)thiourea |
| SMILES | CCNC(=S)NC(C)CCSC |
| InChI | InChI=1S/C8H18N2S2/c1-4-9-8(11)10-7(2)5-6-12-3/h7H,4-6H2,1-3H3,(H2,9,10,11) |
| InChIKey | HOJYISBVYINEQD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|