C10H22N2OS2 — CID 115635665
1-(1-methoxypropan-2-yl)-3-(4-methylsulfanylbutan-2-yl)thiourea (PubChem CID 115635665) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-(4-methylsulfanylbutan-2-yl)thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-(4-methylsulfanylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 115635665 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-(4-methylsulfanylbutan-2-yl)thiourea |
| SMILES | COCC(C)NC(=S)NC(C)CCSC |
| InChI | InChI=1S/C10H22N2OS2/c1-8(5-6-15-4)11-10(14)12-9(2)7-13-3/h8-9H,5-7H2,1-4H3,(H2,11,12,14) |
| InChIKey | CLNMNTBSGCANMP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|