C9H20N2OS2 — CID 115687485
3-(1-methoxypropan-2-yl)-1-methyl-1-(2-methylsulfanylethyl)thiourea (PubChem CID 115687485) has the molecular formula C9H20N2OS2 and a molecular weight of 236.41 g/mol. Its IUPAC name is 3-(1-methoxypropan-2-yl)-1-methyl-1-(2-methylsulfanylethyl)thiourea.
| Compound Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-(2-methylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 115687485 |
| Molecular Formula | C9H20N2OS2 |
| Molecular Weight | 236.41 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-(2-methylsulfanylethyl)thiourea |
| SMILES | COCC(C)NC(=S)N(C)CCSC |
| InChI | InChI=1S/C9H20N2OS2/c1-8(7-12-3)10-9(13)11(2)5-6-14-4/h8H,5-7H2,1-4H3,(H,10,13) |
| InChIKey | ANGKSZPJMBEQKR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|