C10H17N3OS2 — CID 47950516
3-(1-methoxypropan-2-yl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)thiourea (PubChem CID 47950516) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-(1-methoxypropan-2-yl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)thiourea.
| Compound Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 47950516 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-(1,3-thiazol-4-ylmethyl)thiourea |
| SMILES | COCC(C)NC(=S)N(C)Cc1cscn1 |
| InChI | InChI=1S/C10H17N3OS2/c1-8(5-14-3)12-10(15)13(2)4-9-6-16-7-11-9/h6-8H,4-5H2,1-3H3,(H,12,15) |
| InChIKey | QABQXTVFEQRUEQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|