C11H24N2OS — CID 115580720
3-(1-methoxypropan-2-yl)-1-methyl-1-pentan-2-ylthiourea (PubChem CID 115580720) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 3-(1-methoxypropan-2-yl)-1-methyl-1-pentan-2-ylthiourea.
| Compound Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-pentan-2-ylthiourea |
|---|---|
| PubChem CID | 115580720 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-(1-methoxypropan-2-yl)-1-methyl-1-pentan-2-ylthiourea |
| SMILES | CCCC(C)N(C)C(=S)NC(C)COC |
| InChI | InChI=1S/C11H24N2OS/c1-6-7-10(3)13(4)11(15)12-9(2)8-14-5/h9-10H,6-8H2,1-5H3,(H,12,15) |
| InChIKey | LJPROAPISCHXGR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|