C9H18N2O3S — CID 115577228
methyl 3-(1-methoxypropan-2-ylcarbamothioylamino)propanoate (PubChem CID 115577228) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is methyl 3-(1-methoxypropan-2-ylcarbamothioylamino)propanoate.
| Compound Name | methyl 3-(1-methoxypropan-2-ylcarbamothioylamino)propanoate |
|---|---|
| PubChem CID | 115577228 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methyl 3-(1-methoxypropan-2-ylcarbamothioylamino)propanoate |
| SMILES | COCC(C)NC(=S)NCCC(=O)OC |
| InChI | InChI=1S/C9H18N2O3S/c1-7(6-13-2)11-9(15)10-5-4-8(12)14-3/h7H,4-6H2,1-3H3,(H2,10,11,15) |
| InChIKey | HBIUVBZBJNLWMZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|