C7H13F2NOS — CID 103516049
2,2-difluoro-N-(4-methylsulfanylbutan-2-yl)acetamide (PubChem CID 103516049) has the molecular formula C7H13F2NOS and a molecular weight of 197.25 g/mol. Its IUPAC name is 2,2-difluoro-N-(4-methylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(4-methylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 103516049 |
| Molecular Formula | C7H13F2NOS |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2,2-difluoro-N-(4-methylsulfanylbutan-2-yl)acetamide |
| SMILES | CSCCC(C)NC(=O)C(F)F |
| InChI | InChI=1S/C7H13F2NOS/c1-5(3-4-12-2)10-7(11)6(8)9/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | GVOOSNHUKCJZAN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |