C7H13F2NO2 — CID 103513967
2,2-difluoro-N-(5-hydroxypentan-2-yl)acetamide (PubChem CID 103513967) has the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. Its IUPAC name is 2,2-difluoro-N-(5-hydroxypentan-2-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(5-hydroxypentan-2-yl)acetamide |
|---|---|
| PubChem CID | 103513967 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2,2-difluoro-N-(5-hydroxypentan-2-yl)acetamide |
| SMILES | CC(CCCO)NC(=O)C(F)F |
| InChI | InChI=1S/C7H13F2NO2/c1-5(3-2-4-11)10-7(12)6(8)9/h5-6,11H,2-4H2,1H3,(H,10,12) |
| InChIKey | QDYHUXWTRXRVQR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |