C9H19N3O2S — CID 104864380
3-amino-3-hydroxyimino-2-methyl-N-(4-methylsulfanylbutan-2-yl)propanamide (PubChem CID 104864380) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-2-methyl-N-(4-methylsulfanylbutan-2-yl)propanamide.
| Compound Name | 3-amino-3-hydroxyimino-2-methyl-N-(4-methylsulfanylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 104864380 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-amino-3-hydroxyimino-2-methyl-N-(4-methylsulfanylbutan-2-yl)propanamide |
| SMILES | CSCCC(C)NC(=O)C(C)C(N)=NO |
| InChI | InChI=1S/C9H19N3O2S/c1-6(4-5-15-3)11-9(13)7(2)8(10)12-14/h6-7,14H,4-5H2,1-3H3,(H2,10,12)(H,11,13) |
| InChIKey | FUZZLZSORXLMFA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|