C12H25N3O2 — CID 106021394
3-amino-3-hydroxyimino-2-methyl-N-octan-4-ylpropanamide (PubChem CID 106021394) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-2-methyl-N-octan-4-ylpropanamide.
| Compound Name | 3-amino-3-hydroxyimino-2-methyl-N-octan-4-ylpropanamide |
|---|---|
| PubChem CID | 106021394 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 3-amino-3-hydroxyimino-2-methyl-N-octan-4-ylpropanamide |
| SMILES | CCCCC(CCC)NC(=O)C(C)C(N)=NO |
| InChI | InChI=1S/C12H25N3O2/c1-4-6-8-10(7-5-2)14-12(16)9(3)11(13)15-17/h9-10,17H,4-8H2,1-3H3,(H2,13,15)(H,14,16) |
| InChIKey | NGDNPXICZJAABQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|