C14H30N2OS — CID 115687356
1-(2,2-dimethylheptyl)-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 115687356) has the molecular formula C14H30N2OS and a molecular weight of 274.47 g/mol. Its IUPAC name is 1-(2,2-dimethylheptyl)-3-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1-(2,2-dimethylheptyl)-3-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 115687356 |
| Molecular Formula | C14H30N2OS |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 1-(2,2-dimethylheptyl)-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | CCCCCC(C)(C)CNC(=S)NC(C)COC |
| InChI | InChI=1S/C14H30N2OS/c1-6-7-8-9-14(3,4)11-15-13(18)16-12(2)10-17-5/h12H,6-11H2,1-5H3,(H2,15,16,18) |
| InChIKey | OZIGGEFKDHLNAP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|