C21H26FN3O3S — CID 3826893
methyl 5-[[4-[1-(4-fluorophenyl)ethylcarbamothioyl]-1,4-diazepan-1-yl]methyl]furan-2-carboxylate (PubChem CID 3826893) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl 5-[[4-[1-(4-fluorophenyl)ethylcarbamothioyl]-1,4-diazepan-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[1-(4-fluorophenyl)ethylcarbamothioyl]-1,4-diazepan-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3826893 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | methyl 5-[[4-[1-(4-fluorophenyl)ethylcarbamothioyl]-1,4-diazepan-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCCN(C(=S)NC(C)c3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C21H26FN3O3S/c1-15(16-4-6-17(22)7-5-16)23-21(29)25-11-3-10-24(12-13-25)14-18-8-9-19(28-18)20(26)27-2/h4-9,15H,3,10-14H2,1-2H3,(H,23,29) |
| InChIKey | HDEYOVXHQMGBCQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|