C19H21FN2O5 — CID 78877473
methyl 5-[[4-[2-(4-fluorophenoxy)acetyl]piperazin-1-yl]methyl]furan-2-carboxylate (PubChem CID 78877473) has the molecular formula C19H21FN2O5 and a molecular weight of 376.38 g/mol. Its IUPAC name is methyl 5-[[4-[2-(4-fluorophenoxy)acetyl]piperazin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[2-(4-fluorophenoxy)acetyl]piperazin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 78877473 |
| Molecular Formula | C19H21FN2O5 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 5-[[4-[2-(4-fluorophenoxy)acetyl]piperazin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCN(C(=O)COc3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C19H21FN2O5/c1-25-19(24)17-7-6-16(27-17)12-21-8-10-22(11-9-21)18(23)13-26-15-4-2-14(20)3-5-15/h2-7H,8-13H2,1H3 |
| InChIKey | RUYXHYAIBILUMW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |