C22H26FNO8 — CID 71784907
methyl 5-[[4-[(4-fluorophenyl)methoxymethyl]piperidin-1-yl]methyl]furan-2-carboxylate;oxalic acid (PubChem CID 71784907) has the molecular formula C22H26FNO8 and a molecular weight of 451.45 g/mol. Its IUPAC name is methyl 5-[[4-[(4-fluorophenyl)methoxymethyl]piperidin-1-yl]methyl]furan-2-carboxylate;oxalic acid.
| Compound Name | methyl 5-[[4-[(4-fluorophenyl)methoxymethyl]piperidin-1-yl]methyl]furan-2-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 71784907 |
| Molecular Formula | C22H26FNO8 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | methyl 5-[[4-[(4-fluorophenyl)methoxymethyl]piperidin-1-yl]methyl]furan-2-carboxylate;oxalic acid |
| SMILES | COC(=O)c1ccc(CN2CCC(COCc3ccc(F)cc3)CC2)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H24FNO4.C2H2O4/c1-24-20(23)19-7-6-18(26-19)12-22-10-8-16(9-11-22)14-25-13-15-2-4-17(21)5-3-15;3-1(4)2(5)6/h2-7,16H,8-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KQPNQSODDLQXCE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|