C18H28N4S — CID 134437833
4-cyclohexyl-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide (PubChem CID 134437833) has the molecular formula C18H28N4S and a molecular weight of 332.52 g/mol. Its IUPAC name is 4-cyclohexyl-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | 4-cyclohexyl-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 134437833 |
| Molecular Formula | C18H28N4S |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 4-cyclohexyl-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C18H28N4S/c1-14-12-15(2)19-17(13-14)20-18(23)22-10-8-21(9-11-22)16-6-4-3-5-7-16/h12-13,16H,3-11H2,1-2H3,(H,19,20,23) |
| InChIKey | KJUKCHCNHQQHRW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|