C20H31N3O2S — CID 23885078
4-cyclopentyl-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide (PubChem CID 23885078) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 4-cyclopentyl-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-cyclopentyl-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 23885078 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-cyclopentyl-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCN(C3CCCC3)CC2)cc1OC |
| InChI | InChI=1S/C20H31N3O2S/c1-24-18-8-7-16(15-19(18)25-2)9-10-21-20(26)23-13-11-22(12-14-23)17-5-3-4-6-17/h7-8,15,17H,3-6,9-14H2,1-2H3,(H,21,26) |
| InChIKey | QPFHXQZCUYOWMC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|