C23H27N3O2S2 — CID 1430503
4-(1,3-benzothiazol-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-1-carbothioamide (PubChem CID 1430503) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-1-carbothioamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 1430503 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCC(c3nc4ccccc4s3)CC2)cc1OC |
| InChI | InChI=1S/C23H27N3O2S2/c1-27-19-8-7-16(15-20(19)28-2)9-12-24-23(29)26-13-10-17(11-14-26)22-25-18-5-3-4-6-21(18)30-22/h3-8,15,17H,9-14H2,1-2H3,(H,24,29) |
| InChIKey | HNZAHCHWTBYBKD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|