C19H18FN3S2 — CID 1430435
4-(1,3-benzothiazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide (PubChem CID 1430435) has the molecular formula C19H18FN3S2 and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 1430435 |
| Molecular Formula | C19H18FN3S2 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(4-fluorophenyl)piperidine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCC(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C19H18FN3S2/c20-14-5-7-15(8-6-14)21-19(24)23-11-9-13(10-12-23)18-22-16-3-1-2-4-17(16)25-18/h1-8,13H,9-12H2,(H,21,24) |
| InChIKey | RBKSQUXRXWJKSO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|