C24H27N3OS2 — CID 16857544
N-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]-4-tert-butylbenzamide (PubChem CID 16857544) has the molecular formula C24H27N3OS2 and a molecular weight of 437.63 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 16857544 |
| Molecular Formula | C24H27N3OS2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)N2CCC(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3OS2/c1-24(2,3)18-10-8-16(9-11-18)21(28)26-23(29)27-14-12-17(13-15-27)22-25-19-6-4-5-7-20(19)30-22/h4-11,17H,12-15H2,1-3H3,(H,26,28,29) |
| InChIKey | GEJRWAWWXWXWGR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|