C22H29N3O3S — CID 3850542
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3850542) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3850542 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCN(c3ccccc3OC)CC2)cc1OC |
| InChI | InChI=1S/C22H29N3O3S/c1-26-19-7-5-4-6-18(19)24-12-14-25(15-13-24)22(29)23-11-10-17-8-9-20(27-2)21(16-17)28-3/h4-9,16H,10-15H2,1-3H3,(H,23,29) |
| InChIKey | NTPJSUYBBXPPQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|