C23H29N3O4S — CID 2957736
4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide (PubChem CID 2957736) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2957736 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]piperazine-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1OC |
| InChI | InChI=1S/C23H29N3O4S/c1-27-19-5-3-17(13-21(19)28-2)7-8-24-23(31)26-11-9-25(10-12-26)15-18-4-6-20-22(14-18)30-16-29-20/h3-6,13-14H,7-12,15-16H2,1-2H3,(H,24,31) |
| InChIKey | SILSMZCHSZMEFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|