C23H28N4O4S2 — CID 3453626
1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazolidine-1,2-dicarbothioamide (PubChem CID 3453626) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazolidine-1,2-dicarbothioamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazolidine-1,2-dicarbothioamide |
|---|---|
| PubChem CID | 3453626 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazolidine-1,2-dicarbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCCN2C(=S)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C23H28N4O4S2/c1-28-18-6-4-16(12-20(18)29-2)8-9-24-22(32)26-10-3-11-27(26)23(33)25-14-17-5-7-19-21(13-17)31-15-30-19/h4-7,12-13H,3,8-11,14-15H2,1-2H3,(H,24,32)(H,25,33) |
| InChIKey | NUBBSMDUYFDBAH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|