C16H23N3O2S2 — CID 8600244
4-[(3S)-1,1-dioxothiolan-3-yl]-N-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 8600244) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8600244 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN([C@H]3CCS(=O)(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-13-2-4-14(5-3-13)17-16(22)19-9-7-18(8-10-19)15-6-11-23(20,21)12-15/h2-5,15H,6-12H2,1H3,(H,17,22)/t15-/m0/s1 |
| InChIKey | QMWPLSZBELZEFY-HNNXBMFYSA-N |
| XLogP | 1.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|