C20H24BrN3S — CID 153159025
1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione (PubChem CID 153159025) has the molecular formula C20H24BrN3S and a molecular weight of 418.40 g/mol. Its IUPAC name is 1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione.
| Compound Name | 1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione |
|---|---|
| PubChem CID | 153159025 |
| Molecular Formula | C20H24BrN3S |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione |
| SMILES | Cc1cc(C)nc(CC(=S)N2CCN(Cc3ccccc3Br)CC2)c1 |
| InChI | InChI=1S/C20H24BrN3S/c1-15-11-16(2)22-18(12-15)13-20(25)24-9-7-23(8-10-24)14-17-5-3-4-6-19(17)21/h3-6,11-12H,7-10,13-14H2,1-2H3 |
| InChIKey | WBZHDNWKLCWPLL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|