C20H23N3O2S — CID 159587987
4-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]benzoic acid (PubChem CID 159587987) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 159587987 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1cc(C)nc(CC(=S)N2CCN(c3ccc(C(=O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O2S/c1-14-11-15(2)21-17(12-14)13-19(26)23-9-7-22(8-10-23)18-5-3-16(4-6-18)20(24)25/h3-6,11-12H,7-10,13H2,1-2H3,(H,24,25) |
| InChIKey | MJWGJCBVNCMQBY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|