C19H24N4O2S — CID 162226990
[3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]phenyl]-oxoazanium hydroxide (PubChem CID 162226990) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is [3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]phenyl]-oxoazanium hydroxide.
| Compound Name | [3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]phenyl]-oxoazanium hydroxide |
|---|---|
| PubChem CID | 162226990 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethanethioyl]piperazin-1-yl]phenyl]-oxoazanium hydroxide |
| SMILES | Cc1cc(C)nc(CC(=S)N2CCN(c3cccc([NH+]=O)c3)CC2)c1.[OH-] |
| InChI | InChI=1S/C19H22N4OS.H2O/c1-14-10-15(2)20-17(11-14)13-19(25)23-8-6-22(7-9-23)18-5-3-4-16(12-18)21-24;/h3-5,10-12H,6-9,13H2,1-2H3;1H2 |
| InChIKey | CAKGBCWXFABDBG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|