C18H20N2OS — CID 1323719
(2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanethione (PubChem CID 1323719) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanethione.
| Compound Name | (2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanethione |
|---|---|
| PubChem CID | 1323719 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanethione |
| SMILES | Cc1cccc(N2CCN(C(=S)c3ccccc3O)CC2)c1 |
| InChI | InChI=1S/C18H20N2OS/c1-14-5-4-6-15(13-14)19-9-11-20(12-10-19)18(22)16-7-2-3-8-17(16)21/h2-8,13,21H,9-12H2,1H3 |
| InChIKey | DQAIIDCAGISQLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|