C18H19BrN2O2 — CID 27164936
(5-bromo-2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone (PubChem CID 27164936) has the molecular formula C18H19BrN2O2 and a molecular weight of 375.27 g/mol. Its IUPAC name is (5-bromo-2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (5-bromo-2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27164936 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (5-bromo-2-hydroxyphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3cc(Br)ccc3O)CC2)c1 |
| InChI | InChI=1S/C18H19BrN2O2/c1-13-3-2-4-15(11-13)20-7-9-21(10-8-20)18(23)16-12-14(19)5-6-17(16)22/h2-6,11-12,22H,7-10H2,1H3 |
| InChIKey | QMERAFXRCBMXCM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |