C22H21ClN2OS — CID 1292490
[5-(2-chlorophenyl)furan-2-yl]-[4-(3-methylphenyl)piperazin-1-yl]methanethione (PubChem CID 1292490) has the molecular formula C22H21ClN2OS and a molecular weight of 396.94 g/mol. Its IUPAC name is [5-(2-chlorophenyl)furan-2-yl]-[4-(3-methylphenyl)piperazin-1-yl]methanethione.
| Compound Name | [5-(2-chlorophenyl)furan-2-yl]-[4-(3-methylphenyl)piperazin-1-yl]methanethione |
|---|---|
| PubChem CID | 1292490 |
| Molecular Formula | C22H21ClN2OS |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [5-(2-chlorophenyl)furan-2-yl]-[4-(3-methylphenyl)piperazin-1-yl]methanethione |
| SMILES | Cc1cccc(N2CCN(C(=S)c3ccc(-c4ccccc4Cl)o3)CC2)c1 |
| InChI | InChI=1S/C22H21ClN2OS/c1-16-5-4-6-17(15-16)24-11-13-25(14-12-24)22(27)21-10-9-20(26-21)18-7-2-3-8-19(18)23/h2-10,15H,11-14H2,1H3 |
| InChIKey | PYUIJYSBNKFFHI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_amide_A(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|