C22H25F3N2S — CID 149293097
2-(4,6-dimethyl-2-pyridinyl)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethanethione (PubChem CID 149293097) has the molecular formula C22H25F3N2S and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-pyridinyl)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethanethione.
| Compound Name | 2-(4,6-dimethyl-2-pyridinyl)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethanethione |
|---|---|
| PubChem CID | 149293097 |
| Molecular Formula | C22H25F3N2S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-(4,6-dimethyl-2-pyridinyl)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethanethione |
| SMILES | Cc1cc(C)nc(CC(=S)N2CCC(Cc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C22H25F3N2S/c1-15-11-16(2)26-20(12-15)14-21(28)27-9-7-18(8-10-27)13-17-3-5-19(6-4-17)22(23,24)25/h3-6,11-12,18H,7-10,13-14H2,1-2H3 |
| InChIKey | XVFYYJZZZVVONL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|