C22H27F2N3OS — CID 158518926
1-[4-[[3-(1,1-difluoroethoxy)phenyl]methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione (PubChem CID 158518926) has the molecular formula C22H27F2N3OS and a molecular weight of 419.54 g/mol. Its IUPAC name is 1-[4-[[3-(1,1-difluoroethoxy)phenyl]methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione.
| Compound Name | 1-[4-[[3-(1,1-difluoroethoxy)phenyl]methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione |
|---|---|
| PubChem CID | 158518926 |
| Molecular Formula | C22H27F2N3OS |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-[4-[[3-(1,1-difluoroethoxy)phenyl]methyl]piperazin-1-yl]-2-(4,6-dimethyl-2-pyridinyl)ethanethione |
| SMILES | Cc1cc(C)nc(CC(=S)N2CCN(Cc3cccc(OC(C)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C22H27F2N3OS/c1-16-11-17(2)25-19(12-16)14-21(29)27-9-7-26(8-10-27)15-18-5-4-6-20(13-18)28-22(3,23)24/h4-6,11-13H,7-10,14-15H2,1-3H3 |
| InChIKey | VOFBMKFIGSNUQX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|