C15H14F6N2O3 — CID 91749995
[3-[[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91749995) has the molecular formula C15H14F6N2O3 and a molecular weight of 384.28 g/mol. Its IUPAC name is [3-[[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749995 |
| Molecular Formula | C15H14F6N2O3 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [3-[[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(CN2CCN(C(=O)C(F)(F)F)CC2)c1)C(F)(F)F |
| InChI | InChI=1S/C15H14F6N2O3/c16-14(17,18)12(24)23-6-4-22(5-7-23)9-10-2-1-3-11(8-10)26-13(25)15(19,20)21/h1-3,8H,4-7,9H2 |
| InChIKey | TXJMIQBSJGYMTN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|