C15H15F7N2O — CID 3089162
1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 3089162) has the molecular formula C15H15F7N2O and a molecular weight of 372.28 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 3089162 |
| Molecular Formula | C15H15F7N2O |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(N1CCN(Cc2ccccc2)CC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F7N2O/c16-13(17,14(18,19)15(20,21)22)12(25)24-8-6-23(7-9-24)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | YBUNEDWAHOWAET-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|