C17H15ClF10N2O — CID 5085640
1-(4-benzylpiperazin-1-yl)-6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-one (PubChem CID 5085640) has the molecular formula C17H15ClF10N2O and a molecular weight of 488.75 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-one |
|---|---|
| PubChem CID | 5085640 |
| Molecular Formula | C17H15ClF10N2O |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-one |
| SMILES | O=C(N1CCN(Cc2ccccc2)CC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C17H15ClF10N2O/c18-17(27,28)16(25,26)15(23,24)14(21,22)13(19,20)12(31)30-8-6-29(7-9-30)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | BVRVCXLOBKDDCC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|