C20H16F16N2O — CID 3437992
1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one (PubChem CID 3437992) has the molecular formula C20H16F16N2O and a molecular weight of 604.33 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
|---|---|
| PubChem CID | 3437992 |
| Molecular Formula | C20H16F16N2O |
| Molecular Weight | 604.33 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
| SMILES | O=C(N1CCN(Cc2ccccc2)CC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H16F16N2O/c21-12(22)14(23,24)16(27,28)18(31,32)20(35,36)19(33,34)17(29,30)15(25,26)13(39)38-8-6-37(7-9-38)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | QYGDHPNYSFTDIS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.33 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|