C21H16F16N2O3 — CID 3439039
1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one (PubChem CID 3439039) has the molecular formula C21H16F16N2O3 and a molecular weight of 648.34 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
|---|---|
| PubChem CID | 3439039 |
| Molecular Formula | C21H16F16N2O3 |
| Molecular Weight | 648.34 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
| SMILES | O=C(N1CCN(Cc2ccc3c(c2)OCO3)CC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H16F16N2O3/c22-13(23)15(24,25)17(28,29)19(32,33)21(36,37)20(34,35)18(30,31)16(26,27)14(40)39-5-3-38(4-6-39)8-10-1-2-11-12(7-10)42-9-41-11/h1-2,7,13H,3-6,8-9H2 |
| InChIKey | FIMHOQDWHSIXTR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|