C19H16F4N2O3 — CID 2361184
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 2361184) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 2361184 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H16F4N2O3/c20-13-8-12(16(21)18(23)17(13)22)19(26)25-5-3-24(4-6-25)9-11-1-2-14-15(7-11)28-10-27-14/h1-2,7-8H,3-6,9-10H2 |
| InChIKey | ZJIXTAYCYNGZSL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|