C26H22F4N2O4 — CID 19293180
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methanone (PubChem CID 19293180) has the molecular formula C26H22F4N2O4 and a molecular weight of 502.46 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 19293180 |
| Molecular Formula | C26H22F4N2O4 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]methanone |
| SMILES | O=C(c1ccc(COc2c(F)c(F)cc(F)c2F)cc1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C26H22F4N2O4/c27-19-12-20(28)24(30)25(23(19)29)34-14-16-1-4-18(5-2-16)26(33)32-9-7-31(8-10-32)13-17-3-6-21-22(11-17)36-15-35-21/h1-6,11-12H,7-10,13-15H2 |
| InChIKey | NXHKSYLRZREINX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|