C26H21F7N2O2 — CID 19329612
[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 19329612) has the molecular formula C26H21F7N2O2 and a molecular weight of 526.45 g/mol. Its IUPAC name is [4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | [4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19329612 |
| Molecular Formula | C26H21F7N2O2 |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(COc2c(F)c(F)cc(F)c2F)cc1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H21F7N2O2/c27-20-13-21(28)23(30)24(22(20)29)37-15-16-4-6-18(7-5-16)25(36)35-10-8-34(9-11-35)14-17-2-1-3-19(12-17)26(31,32)33/h1-7,12-13H,8-11,14-15H2 |
| InChIKey | KGTKVBZMMRDHRK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|