C24H18Cl5F3N2O3 — CID 19329641
[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 19329641) has the molecular formula C24H18Cl5F3N2O3 and a molecular weight of 616.68 g/mol. Its IUPAC name is [5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | [5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19329641 |
| Molecular Formula | C24H18Cl5F3N2O3 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 613.97 |
| IUPAC Name | [5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H18Cl5F3N2O3/c25-17-18(26)20(28)22(21(29)19(17)27)36-12-15-4-5-16(37-15)23(35)34-8-6-33(7-9-34)11-13-2-1-3-14(10-13)24(30,31)32/h1-5,10H,6-9,11-12H2 |
| InChIKey | VWYZOXZMWMTDKP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|