C23H18Cl5FN2O3 — CID 19323472
[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19323472) has the molecular formula C23H18Cl5FN2O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19323472 |
| Molecular Formula | C23H18Cl5FN2O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 563.97 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H18Cl5FN2O3/c24-17-18(25)20(27)22(21(28)19(17)26)33-12-15-5-6-16(34-15)23(32)31-9-7-30(8-10-31)11-13-1-3-14(29)4-2-13/h1-6H,7-12H2 |
| InChIKey | YBRORLSOXRGYDR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|