C23H17Cl7N2O3 — CID 19296949
[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19296949) has the molecular formula C23H17Cl7N2O3 and a molecular weight of 617.57 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19296949 |
| Molecular Formula | C23H17Cl7N2O3 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 613.91 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C23H17Cl7N2O3/c24-13-2-1-12(15(25)9-13)10-31-5-7-32(8-6-31)23(33)16-4-3-14(35-16)11-34-22-20(29)18(27)17(26)19(28)21(22)30/h1-4,9H,5-8,10-11H2 |
| InChIKey | LWWLMBOXYLMGPX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|