C22H19F4N3O3 — CID 19572723
[4-(pyridin-3-ylmethyl)piperazin-1-yl]-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19572723) has the molecular formula C22H19F4N3O3 and a molecular weight of 449.40 g/mol. Its IUPAC name is [4-(pyridin-3-ylmethyl)piperazin-1-yl]-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-(pyridin-3-ylmethyl)piperazin-1-yl]-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19572723 |
| Molecular Formula | C22H19F4N3O3 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [4-(pyridin-3-ylmethyl)piperazin-1-yl]-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2c(F)c(F)cc(F)c2F)o1)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H19F4N3O3/c23-16-10-17(24)20(26)21(19(16)25)31-13-15-3-4-18(32-15)22(30)29-8-6-28(7-9-29)12-14-2-1-5-27-11-14/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | NOTHBEVEUGNINJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|