C22H22BrN3O3 — CID 19572656
[5-[(4-bromophenoxy)methyl]furan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 19572656) has the molecular formula C22H22BrN3O3 and a molecular weight of 456.34 g/mol. Its IUPAC name is [5-[(4-bromophenoxy)methyl]furan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [5-[(4-bromophenoxy)methyl]furan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19572656 |
| Molecular Formula | C22H22BrN3O3 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [5-[(4-bromophenoxy)methyl]furan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc(Br)cc2)o1)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H22BrN3O3/c23-18-3-5-19(6-4-18)28-16-20-7-8-21(29-20)22(27)26-12-10-25(11-13-26)15-17-2-1-9-24-14-17/h1-9,14H,10-13,15-16H2 |
| InChIKey | UOKJYWZYXONHEP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |