C25H17Cl5F3N3O3 — CID 19394169
N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19394169) has the molecular formula C25H17Cl5F3N3O3 and a molecular weight of 641.69 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19394169 |
| Molecular Formula | C25H17Cl5F3N3O3 |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 638.97 |
| IUPAC Name | N-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2cccc(C(F)(F)F)c2)c(C)c1NC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H17Cl5F3N3O3/c1-11-22(12(2)36(35-11)9-13-4-3-5-14(8-13)25(31,32)33)34-24(37)16-7-6-15(39-16)10-38-23-20(29)18(27)17(26)19(28)21(23)30/h3-8H,9-10H2,1-2H3,(H,34,37) |
| InChIKey | MDHNFMKNAYEIKR-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|