C24H16Cl2F5N3O3 — CID 19337718
N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19337718) has the molecular formula C24H16Cl2F5N3O3 and a molecular weight of 560.31 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19337718 |
| Molecular Formula | C24H16Cl2F5N3O3 |
| Molecular Weight | 560.31 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1NC(=O)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C24H16Cl2F5N3O3/c1-10-22(11(2)34(33-10)8-13-14(25)4-3-5-15(13)26)32-24(35)16-7-6-12(37-16)9-36-23-20(30)18(28)17(27)19(29)21(23)31/h3-7H,8-9H2,1-2H3,(H,32,35) |
| InChIKey | DUPVMSOJVFLRFT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|