C24H17Cl6N3O3 — CID 19335572
N-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19335572) has the molecular formula C24H17Cl6N3O3 and a molecular weight of 608.14 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19335572 |
| Molecular Formula | C24H17Cl6N3O3 |
| Molecular Weight | 608.14 g/mol |
| Exact Mass | 604.94 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1NC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C24H17Cl6N3O3/c1-11-22(12(2)33(32-11)9-13-5-3-4-6-15(13)25)31-24(34)16-8-7-14(36-16)10-35-23-20(29)18(27)17(26)19(28)21(23)30/h3-8H,9-10H2,1-2H3,(H,31,34) |
| InChIKey | YBKQAMMZAGVMGN-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.14 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|