C25H22Cl2N4O5 — CID 19336014
N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19336014) has the molecular formula C25H22Cl2N4O5 and a molecular weight of 529.38 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19336014 |
| Molecular Formula | C25H22Cl2N4O5 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)Nc3c(C)nn(Cc4c(Cl)cccc4Cl)c3C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22Cl2N4O5/c1-14-7-9-22(21(11-14)31(33)34)35-13-17-8-10-23(36-17)25(32)28-24-15(2)29-30(16(24)3)12-18-19(26)5-4-6-20(18)27/h4-11H,12-13H2,1-3H3,(H,28,32) |
| InChIKey | OQWLABMPQMDCMI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|