C20H24BrN3S — CID 19291663
4-[(2-bromophenyl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide (PubChem CID 19291663) has the molecular formula C20H24BrN3S and a molecular weight of 418.40 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(2-bromophenyl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291663 |
| Molecular Formula | C20H24BrN3S |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-[(2-bromophenyl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide |
| SMILES | CCc1ccc(NC(=S)N2CCN(Cc3ccccc3Br)CC2)cc1 |
| InChI | InChI=1S/C20H24BrN3S/c1-2-16-7-9-18(10-8-16)22-20(25)24-13-11-23(12-14-24)15-17-5-3-4-6-19(17)21/h3-10H,2,11-15H2,1H3,(H,22,25) |
| InChIKey | LMWXSAHJGAMGBK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|