C23H28BrN3S — CID 1100287
(1R,5S)-7-[(2-bromophenyl)methyl]-1,5-dimethyl-N-phenyl-3,7-diazabicyclo[3.3.1]nonane-3-carbothioamide (PubChem CID 1100287) has the molecular formula C23H28BrN3S and a molecular weight of 458.47 g/mol. Its IUPAC name is (1R,5S)-7-[(2-bromophenyl)methyl]-1,5-dimethyl-N-phenyl-3,7-diazabicyclo[3.3.1]nonane-3-carbothioamide.
| Compound Name | (1R,5S)-7-[(2-bromophenyl)methyl]-1,5-dimethyl-N-phenyl-3,7-diazabicyclo[3.3.1]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 1100287 |
| Molecular Formula | C23H28BrN3S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (1R,5S)-7-[(2-bromophenyl)methyl]-1,5-dimethyl-N-phenyl-3,7-diazabicyclo[3.3.1]nonane-3-carbothioamide |
| SMILES | C[C@]12CN(Cc3ccccc3Br)C[C@](C)(CN(C(=S)Nc3ccccc3)C1)C2 |
| InChI | InChI=1S/C23H28BrN3S/c1-22-13-23(2,15-26(14-22)12-18-8-6-7-11-20(18)24)17-27(16-22)21(28)25-19-9-4-3-5-10-19/h3-11H,12-17H2,1-2H3,(H,25,28)/t22-,23+ |
| InChIKey | XMSYYNBUKFUHCL-ZRZAMGCNSA-N |
| XLogP | 5.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|